C19H24N2 — CID 123520407
2-[3-(cyclohepta-1,3,6-trien-1-ylmethylimino)-5,5-dimethylcyclohexen-1-yl]propanenitrile (PubChem CID 123520407) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[3-(cyclohepta-1,3,6-trien-1-ylmethylimino)-5,5-dimethylcyclohexen-1-yl]propanenitrile.
| Compound Name | 2-[3-(cyclohepta-1,3,6-trien-1-ylmethylimino)-5,5-dimethylcyclohexen-1-yl]propanenitrile |
|---|---|
| PubChem CID | 123520407 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2-[3-(cyclohepta-1,3,6-trien-1-ylmethylimino)-5,5-dimethylcyclohexen-1-yl]propanenitrile |
| SMILES | CC(C#N)C1=C/C(=N\CC2=CC=CCC=C2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H24N2/c1-15(13-20)17-10-18(12-19(2,3)11-17)21-14-16-8-6-4-5-7-9-16/h4,6-10,15H,5,11-12,14H2,1-3H3/b21-18+ |
| InChIKey | BMXFFSASIAVYTA-DYTRJAOYSA-N |
| XLogP | 4.78 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|