C16H24N2 — CID 173388349
2,3,5-trimethyl-6-(4-prop-1-en-2-ylcyclohexen-1-yl)-2,3-dihydropyrazine (PubChem CID 173388349) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-(4-prop-1-en-2-ylcyclohexen-1-yl)-2,3-dihydropyrazine.
| Compound Name | 2,3,5-trimethyl-6-(4-prop-1-en-2-ylcyclohexen-1-yl)-2,3-dihydropyrazine |
|---|---|
| PubChem CID | 173388349 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2,3,5-trimethyl-6-(4-prop-1-en-2-ylcyclohexen-1-yl)-2,3-dihydropyrazine |
| SMILES | C=C(C)C1CC=C(C2=NC(C)C(C)N=C2C)CC1 |
| InChI | InChI=1S/C16H24N2/c1-10(2)14-6-8-15(9-7-14)16-13(5)17-11(3)12(4)18-16/h8,11-12,14H,1,6-7,9H2,2-5H3 |
| InChIKey | NUFJBLSDPIXXQR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|