C11H13N3 — CID 123966619
2-(3-imino-5,5-dimethylcyclohexen-1-yl)propanedinitrile (PubChem CID 123966619) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 2-(3-imino-5,5-dimethylcyclohexen-1-yl)propanedinitrile.
| Compound Name | 2-(3-imino-5,5-dimethylcyclohexen-1-yl)propanedinitrile |
|---|---|
| PubChem CID | 123966619 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2-(3-imino-5,5-dimethylcyclohexen-1-yl)propanedinitrile |
| SMILES | [H]/N=C1\C=C(C(C#N)C#N)CC(C)(C)C1 |
| InChI | InChI=1S/C11H13N3/c1-11(2)4-8(3-10(14)5-11)9(6-12)7-13/h3,9,14H,4-5H2,1-2H3/b14-10+ |
| InChIKey | FODABGSZFMCDSD-GXDHUFHOSA-N |
| XLogP | 2.42 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|