C14H24N2 — CID 123550740
6-ethyl-5,7-dimethyl-7-propylcyclohept-4-ene-1,3-diimine (PubChem CID 123550740) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 6-ethyl-5,7-dimethyl-7-propylcyclohept-4-ene-1,3-diimine.
| Compound Name | 6-ethyl-5,7-dimethyl-7-propylcyclohept-4-ene-1,3-diimine |
|---|---|
| PubChem CID | 123550740 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 6-ethyl-5,7-dimethyl-7-propylcyclohept-4-ene-1,3-diimine |
| SMILES | [H]/N=C1\C=C(C)C(CC)C(C)(CCC)/C(=N/[H])C1 |
| InChI | InChI=1S/C14H24N2/c1-5-7-14(4)12(6-2)10(3)8-11(15)9-13(14)16/h8,12,15-16H,5-7,9H2,1-4H3/b15-11+,16-13+ |
| InChIKey | GCNPRLYNQCCWIM-NWFDBUFXSA-N |
| XLogP | 4.21 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|