C17H31N2P — CID 90790271
3,8,8-trimethyl-6-(3-methylpentan-3-yl)-3-phosphanylcyclooct-5-ene-1,4-diimine (PubChem CID 90790271) has the molecular formula C17H31N2P and a molecular weight of 294.42 g/mol. Its IUPAC name is 3,8,8-trimethyl-6-(3-methylpentan-3-yl)-3-phosphanylcyclooct-5-ene-1,4-diimine.
| Compound Name | 3,8,8-trimethyl-6-(3-methylpentan-3-yl)-3-phosphanylcyclooct-5-ene-1,4-diimine |
|---|---|
| PubChem CID | 90790271 |
| Molecular Formula | C17H31N2P |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 3,8,8-trimethyl-6-(3-methylpentan-3-yl)-3-phosphanylcyclooct-5-ene-1,4-diimine |
| SMILES | [H]/N=C1\CC(C)(P)/C(=N/[H])C=C(C(C)(CC)CC)CC1(C)C |
| InChI | InChI=1S/C17H31N2P/c1-7-16(5,8-2)12-9-13(18)17(6,20)11-14(19)15(3,4)10-12/h9,18-19H,7-8,10-11,20H2,1-6H3/b12-9?,18-13+,19-14+ |
| InChIKey | GGCPUDQCAMOYBP-HBWUHVADSA-N |
| XLogP | 5.23 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|