C30H55N — CID 123216111
3,9,10,13-tetramethyl-6-methylidene-8-(5,5,6-trimethylheptan-2-yl)pentadeca-2,13-dien-7-imine (PubChem CID 123216111) has the molecular formula C30H55N and a molecular weight of 429.78 g/mol. Its IUPAC name is 3,9,10,13-tetramethyl-6-methylidene-8-(5,5,6-trimethylheptan-2-yl)pentadeca-2,13-dien-7-imine.
| Compound Name | 3,9,10,13-tetramethyl-6-methylidene-8-(5,5,6-trimethylheptan-2-yl)pentadeca-2,13-dien-7-imine |
|---|---|
| PubChem CID | 123216111 |
| Molecular Formula | C30H55N |
| Molecular Weight | 429.78 g/mol |
| Exact Mass | 429.43 |
| IUPAC Name | 3,9,10,13-tetramethyl-6-methylidene-8-(5,5,6-trimethylheptan-2-yl)pentadeca-2,13-dien-7-imine |
| SMILES | [H]/N=C(\C(=C)CCC(C)=CC)C(C(C)CCC(C)(C)C(C)C)C(C)C(C)CCC(C)=CC |
| InChI | InChI=1S/C30H55N/c1-13-22(5)15-17-24(7)27(10)28(25(8)19-20-30(11,12)21(3)4)29(31)26(9)18-16-23(6)14-2/h13-14,21,24-25,27-28,31H,9,15-20H2,1-8,10-12H3/b22-13?,23-14?,31-29+ |
| InChIKey | ZQDUSYXQQXQXCW-FALGKCEOSA-N |
| XLogP | 10.04 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.78 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|