C12H21N — CID 123236420
7-ethyl-3,5,5-trimethylcyclohept-2-en-1-imine (PubChem CID 123236420) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 7-ethyl-3,5,5-trimethylcyclohept-2-en-1-imine.
| Compound Name | 7-ethyl-3,5,5-trimethylcyclohept-2-en-1-imine |
|---|---|
| PubChem CID | 123236420 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 7-ethyl-3,5,5-trimethylcyclohept-2-en-1-imine |
| SMILES | [H]/N=C1\C=C(C)CC(C)(C)CC1CC |
| InChI | InChI=1S/C12H21N/c1-5-10-8-12(3,4)7-9(2)6-11(10)13/h6,10,13H,5,7-8H2,1-4H3/b13-11+ |
| InChIKey | LOVHBIRYWNNPES-ACCUITESSA-N |
| XLogP | 3.80 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|