C19H18Cl4N2O2 — CID 72722181
2-[bis(2-chloroethyl)amino]-N-[4-chloro-2-(4-chlorobenzoyl)phenyl]acetamide (PubChem CID 72722181) has the molecular formula C19H18Cl4N2O2 and a molecular weight of 448.18 g/mol. Its IUPAC name is 2-[bis(2-chloroethyl)amino]-N-[4-chloro-2-(4-chlorobenzoyl)phenyl]acetamide.
| Compound Name | 2-[bis(2-chloroethyl)amino]-N-[4-chloro-2-(4-chlorobenzoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 72722181 |
| Molecular Formula | C19H18Cl4N2O2 |
| Molecular Weight | 448.18 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 2-[bis(2-chloroethyl)amino]-N-[4-chloro-2-(4-chlorobenzoyl)phenyl]acetamide |
| SMILES | O=C(CN(CCCl)CCCl)Nc1ccc(Cl)cc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18Cl4N2O2/c20-7-9-25(10-8-21)12-18(26)24-17-6-5-15(23)11-16(17)19(27)13-1-3-14(22)4-2-13/h1-6,11H,7-10,12H2,(H,24,26) |
| InChIKey | WLMJTJZBAXKSIT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.18 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|