C21H21F3OSi — CID 72723164
(2Z)-3-[dimethyl(phenyl)silyl]-2-[[4-(trifluoromethyl)phenyl]methylidene]cyclopentan-1-one (PubChem CID 72723164) has the molecular formula C21H21F3OSi and a molecular weight of 374.48 g/mol. Its IUPAC name is (2Z)-3-[dimethyl(phenyl)silyl]-2-[[4-(trifluoromethyl)phenyl]methylidene]cyclopentan-1-one.
| Compound Name | (2Z)-3-[dimethyl(phenyl)silyl]-2-[[4-(trifluoromethyl)phenyl]methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 72723164 |
| Molecular Formula | C21H21F3OSi |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (2Z)-3-[dimethyl(phenyl)silyl]-2-[[4-(trifluoromethyl)phenyl]methylidene]cyclopentan-1-one |
| SMILES | C[Si](C)(c1ccccc1)C1CCC(=O)/C1=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F3OSi/c1-26(2,17-6-4-3-5-7-17)20-13-12-19(25)18(20)14-15-8-10-16(11-9-15)21(22,23)24/h3-11,14,20H,12-13H2,1-2H3/b18-14- |
| InChIKey | MLYDDPJFZOQPMW-JXAWBTAJSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|