C25H25F3N4O2 — CID 72724989
N-cyclohexyl-4-[[5-methyl-4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]amino]benzamide (PubChem CID 72724989) has the molecular formula C25H25F3N4O2 and a molecular weight of 470.50 g/mol. Its IUPAC name is N-cyclohexyl-4-[[5-methyl-4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]amino]benzamide.
| Compound Name | N-cyclohexyl-4-[[5-methyl-4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 72724989 |
| Molecular Formula | C25H25F3N4O2 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-cyclohexyl-4-[[5-methyl-4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]amino]benzamide |
| SMILES | Cc1cnc(Nc2ccc(C(=O)NC3CCCCC3)cc2)nc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H25F3N4O2/c1-16-15-29-24(32-22(16)17-9-13-21(14-10-17)34-25(26,27)28)31-20-11-7-18(8-12-20)23(33)30-19-5-3-2-4-6-19/h7-15,19H,2-6H2,1H3,(H,30,33)(H,29,31,32) |
| InChIKey | GCLOLVKYSGLEKJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |