C34H48O11 — CID 72730332
[2-[4-acetyloxy-4a-(acetyloxymethyl)-1,2-dimethyl-8-(2-methylbut-2-enoyloxy)spiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxirane]-1-yl]-1-(5-oxo-2H-furan-3-yl)ethyl] 2-methylbutanoate (PubChem CID 72730332) has the molecular formula C34H48O11 and a molecular weight of 632.75 g/mol. Its IUPAC name is [2-[4-acetyloxy-4a-(acetyloxymethyl)-1,2-dimethyl-8-(2-methylbut-2-enoyloxy)spiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxirane]-1-yl]-1-(5-oxo-2H-furan-3-yl)ethyl] 2-methylbutanoate.
| Compound Name | [2-[4-acetyloxy-4a-(acetyloxymethyl)-1,2-dimethyl-8-(2-methylbut-2-enoyloxy)spiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxirane]-1-yl]-1-(5-oxo-2H-furan-3-yl)ethyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 72730332 |
| Molecular Formula | C34H48O11 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | [2-[4-acetyloxy-4a-(acetyloxymethyl)-1,2-dimethyl-8-(2-methylbut-2-enoyloxy)spiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxirane]-1-yl]-1-(5-oxo-2H-furan-3-yl)ethyl] 2-methylbutanoate |
| SMILES | CC=C(C)C(=O)OC1CCC2(CO2)C2(COC(C)=O)C(OC(C)=O)CC(C)C(C)(CC(OC(=O)C(C)CC)C3=CC(=O)OC3)C12 |
| InChI | InChI=1S/C34H48O11/c1-9-19(3)30(38)44-25-11-12-33(17-42-33)34(18-41-22(6)35)27(43-23(7)36)13-21(5)32(8,29(25)34)15-26(24-14-28(37)40-16-24)45-31(39)20(4)10-2/h9,14,20-21,25-27,29H,10-13,15-18H2,1-8H3 |
| InChIKey | JTNPKPFJZRMAJE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 144.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|