C10H18O3 — CID 72732359
3-(hydroxymethyl)-7-methylocta-2,7-diene-1,6-diol (PubChem CID 72732359) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-(hydroxymethyl)-7-methylocta-2,7-diene-1,6-diol.
| Compound Name | 3-(hydroxymethyl)-7-methylocta-2,7-diene-1,6-diol |
|---|---|
| PubChem CID | 72732359 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 3-(hydroxymethyl)-7-methylocta-2,7-diene-1,6-diol |
| SMILES | C=C(C)C(O)CCC(=CCO)CO |
| InChI | InChI=1S/C10H18O3/c1-8(2)10(13)4-3-9(7-12)5-6-11/h5,10-13H,1,3-4,6-7H2,2H3 |
| InChIKey | RDOGOMPUCIUOGB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|