C19H19ClN2OSe — CID 72736553
2-(1-benzylpiperidin-4-yl)-6-chloro-1,2-benzoselenazol-3-one (PubChem CID 72736553) has the molecular formula C19H19ClN2OSe and a molecular weight of 405.79 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-6-chloro-1,2-benzoselenazol-3-one.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-6-chloro-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 72736553 |
| Molecular Formula | C19H19ClN2OSe |
| Molecular Weight | 405.79 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-6-chloro-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccc(Cl)cc2[se]n1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H19ClN2OSe/c20-15-6-7-17-18(12-15)24-22(19(17)23)16-8-10-21(11-9-16)13-14-4-2-1-3-5-14/h1-7,12,16H,8-11,13H2 |
| InChIKey | HYQXXJPDFKHWQZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|