C26H49NO7Si — CID 72736990
ditert-butyl (2S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidine-1,2-dicarboxylate (PubChem CID 72736990) has the molecular formula C26H49NO7Si and a molecular weight of 515.76 g/mol. Its IUPAC name is ditert-butyl (2S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 72736990 |
| Molecular Formula | C26H49NO7Si |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 515.33 |
| IUPAC Name | ditert-butyl (2S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]([C@H]2COC(C)(C)O2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H49NO7Si/c1-23(2,3)33-21(28)18-14-17(15-31-35(12,13)25(7,8)9)20(19-16-30-26(10,11)32-19)27(18)22(29)34-24(4,5)6/h17-20H,14-16H2,1-13H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | QPERJSPVOKGQIE-IYWMVGAKSA-N |
| XLogP | 5.50 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|