C23H45NO7Si — CID 90896148
ditert-butyl (5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(1,2-dihydroxyethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 90896148) has the molecular formula C23H45NO7Si and a molecular weight of 475.70 g/mol. Its IUPAC name is ditert-butyl (5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(1,2-dihydroxyethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(1,2-dihydroxyethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90896148 |
| Molecular Formula | C23H45NO7Si |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | ditert-butyl (5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(1,2-dihydroxyethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(CO[Si](C)(C)C(C)(C)C)[C@H](C(O)CO)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H45NO7Si/c1-21(2,3)30-19(27)16-12-15(14-29-32(10,11)23(7,8)9)18(17(26)13-25)24(16)20(28)31-22(4,5)6/h15-18,25-26H,12-14H2,1-11H3/t15?,16?,17?,18-/m1/s1 |
| InChIKey | XUYISRMMIMDPQU-VHYNJHTPSA-N |
| XLogP | 3.70 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|