About 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate
3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate (PubChem CID 72737571) has the molecular formula C19H24O3
and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate |
| PubChem CID | 72737571 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate |
| SMILES | CC(C)=CCOC(=O)/C=C/C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24O3/c1-14(2)12-13-22-18(21)11-10-17(20)15-6-8-16(9-7-15)19(3,4)5/h6-12H,13H2,1-5H3/b11-10+ |
| InChIKey | AHHXISKBQIWGPL-ZHACJKMWSA-N |
| XLogP | 4.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate?
The IUPAC name of 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate (CID 72737571) is 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate.
What is the SMILES notation for 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate?
The canonical SMILES for 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate is CC(C)=CCOC(=O)/C=C/C(=O)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate?
The InChIKey is AHHXISKBQIWGPL-ZHACJKMWSA-N. The full InChI is InChI=1S/C19H24O3/c1-14(2)12-13-22-18(21)11-10-17(20)15-6-8-16(9-7-15)19(3,4)5/h6-12H,13H2,1-5H3/b11-10+.
What are the key properties of 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate?
3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate has a molecular weight of 300.40 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl (E)-4-(4-tert-butylphenyl)-4-oxobut-2-enoate is sourced from PubChem (CID 72737571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).