About iodozinc(1+);methyl hexanoate
iodozinc(1+);methyl hexanoate (PubChem CID 72738635) has the molecular formula C7H13IO2Zn
and a molecular weight of 321.47 g/mol. Its IUPAC name is iodozinc(1+);methyl hexanoate.
Molecular Properties
| Compound Name | iodozinc(1+);methyl hexanoate |
| PubChem CID | 72738635 |
| Molecular Formula | C7H13IO2Zn |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | iodozinc(1+);methyl hexanoate |
| SMILES | [CH2-]CCCCC(=O)OC.[Zn+]I |
| InChI | InChI=1S/C7H13O2.HI.Zn/c1-3-4-5-6-7(8)9-2;;/h1,3-6H2,2H3;1H;/q-1;;+2/p-1 |
| InChIKey | POSWEUHODYLTFF-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodozinc(1+);methyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodozinc(1+);methyl hexanoate?
The IUPAC name of iodozinc(1+);methyl hexanoate (CID 72738635) is iodozinc(1+);methyl hexanoate.
What is the SMILES notation for iodozinc(1+);methyl hexanoate?
The canonical SMILES for iodozinc(1+);methyl hexanoate is [CH2-]CCCCC(=O)OC.[Zn+]I.
What is the InChIKey of iodozinc(1+);methyl hexanoate?
The InChIKey is POSWEUHODYLTFF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13O2.HI.Zn/c1-3-4-5-6-7(8)9-2;;/h1,3-6H2,2H3;1H;/q-1;;+2/p-1.
What are the key properties of iodozinc(1+);methyl hexanoate?
iodozinc(1+);methyl hexanoate has a molecular weight of 321.47 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodozinc(1+);methyl hexanoate is sourced from PubChem (CID 72738635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).