C26H30O6 — CID 72739175
3-[3-hydroxy-4-methoxy-2,5-bis(3-methylbut-2-enyl)phenyl]-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one (PubChem CID 72739175) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is 3-[3-hydroxy-4-methoxy-2,5-bis(3-methylbut-2-enyl)phenyl]-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[3-hydroxy-4-methoxy-2,5-bis(3-methylbut-2-enyl)phenyl]-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 72739175 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 3-[3-hydroxy-4-methoxy-2,5-bis(3-methylbut-2-enyl)phenyl]-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1c(CC=C(C)C)cc(C=CC(=O)c2c(O)cc(O)cc2O)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C26H30O6/c1-15(2)6-8-18-12-17(20(10-7-16(3)4)25(31)26(18)32-5)9-11-21(28)24-22(29)13-19(27)14-23(24)30/h6-7,9,11-14,27,29-31H,8,10H2,1-5H3 |
| InChIKey | BTVGKIWEGFQOTG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|