C10H15N5O5 — CID 72740686
1-[3-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 72740686) has the molecular formula C10H15N5O5 and a molecular weight of 285.26 g/mol. Its IUPAC name is 1-[3-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1-[3-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 72740686 |
| Molecular Formula | C10H15N5O5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[3-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | CC1CN(C2OC(CO)C(O)C2N=[N+]=[N-])C(=O)NC1=O |
| InChI | InChI=1S/C10H15N5O5/c1-4-2-15(10(19)12-8(4)18)9-6(13-14-11)7(17)5(3-16)20-9/h4-7,9,16-17H,2-3H2,1H3,(H,12,18,19) |
| InChIKey | WRXZZHWKCZOTCB-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 147.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|