C24H29NO2 — CID 72744161
8-(3,7-dimethylocta-2,6-dienyl)-7-methoxy-3-methyl-9H-carbazol-2-ol (PubChem CID 72744161) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 8-(3,7-dimethylocta-2,6-dienyl)-7-methoxy-3-methyl-9H-carbazol-2-ol.
| Compound Name | 8-(3,7-dimethylocta-2,6-dienyl)-7-methoxy-3-methyl-9H-carbazol-2-ol |
|---|---|
| PubChem CID | 72744161 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 8-(3,7-dimethylocta-2,6-dienyl)-7-methoxy-3-methyl-9H-carbazol-2-ol |
| SMILES | COc1ccc2c([nH]c3cc(O)c(C)cc32)c1CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C24H29NO2/c1-15(2)7-6-8-16(3)9-10-19-23(27-5)12-11-18-20-13-17(4)22(26)14-21(20)25-24(18)19/h7,9,11-14,25-26H,6,8,10H2,1-5H3 |
| InChIKey | OFHARTBNOLXMFZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|