C7H14N3S+ — CID 7275533
5-methyl-1-prop-2-enyl-1,3,5-triazinan-5-ium-2-thione (PubChem CID 7275533) has the molecular formula C7H14N3S+ and a molecular weight of 172.28 g/mol. Its IUPAC name is 5-methyl-1-prop-2-enyl-1,3,5-triazinan-5-ium-2-thione.
| Compound Name | 5-methyl-1-prop-2-enyl-1,3,5-triazinan-5-ium-2-thione |
|---|---|
| PubChem CID | 7275533 |
| Molecular Formula | C7H14N3S+ |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 5-methyl-1-prop-2-enyl-1,3,5-triazinan-5-ium-2-thione |
| SMILES | C=CCN1C[NH+](C)CNC1=S |
| InChI | InChI=1S/C7H13N3S/c1-3-4-10-6-9(2)5-8-7(10)11/h3H,1,4-6H2,2H3,(H,8,11)/p+1 |
| InChIKey | VTURBCGKMIWRLS-UHFFFAOYSA-O |
| XLogP | -1.21 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|