C30H35F3N2O4 — CID 72763902
1-[[5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-3-methoxy-7,8-dihydro-6H-naphthalen-2-yl]methyl]azetidine-3-carboxylic acid (PubChem CID 72763902) has the molecular formula C30H35F3N2O4 and a molecular weight of 544.61 g/mol. Its IUPAC name is 1-[[5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-3-methoxy-7,8-dihydro-6H-naphthalen-2-yl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-3-methoxy-7,8-dihydro-6H-naphthalen-2-yl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72763902 |
| Molecular Formula | C30H35F3N2O4 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 1-[[5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-3-methoxy-7,8-dihydro-6H-naphthalen-2-yl]methyl]azetidine-3-carboxylic acid |
| SMILES | COc1cc2c(cc1CN1CC(C(=O)O)C1)CCCC2=NOCc1ccc(C2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H35F3N2O4/c1-38-28-14-25-21(13-22(28)15-35-16-23(17-35)29(36)37)8-5-9-27(25)34-39-18-19-10-11-24(20-6-3-2-4-7-20)26(12-19)30(31,32)33/h10-14,20,23H,2-9,15-18H2,1H3,(H,36,37) |
| InChIKey | UXOSEONDYXAAQY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|