About (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate
(5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate (PubChem CID 72786069) has the molecular formula C20H26F2O2
and a molecular weight of 336.42 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate |
| PubChem CID | 72786069 |
| Molecular Formula | C20H26F2O2 |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C2CC2c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C20H26F2O2/c1-11(2)14-6-4-12(3)8-19(14)24-20(23)16-10-15(16)13-5-7-17(21)18(22)9-13/h5,7,9,11-12,14-16,19H,4,6,8,10H2,1-3H3 |
| InChIKey | SCHLPHPIGQOKEA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate (CID 72786069) is (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate is CC1CCC(C(C)C)C(OC(=O)C2CC2c2ccc(F)c(F)c2)C1.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate?
The InChIKey is SCHLPHPIGQOKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26F2O2/c1-11(2)14-6-4-12(3)8-19(14)24-20(23)16-10-15(16)13-5-7-17(21)18(22)9-13/h5,7,9,11-12,14-16,19H,4,6,8,10H2,1-3H3.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate?
(5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate has a molecular weight of 336.42 g/mol, XLogP of 5.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) 2-(3,4-difluorophenyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 72786069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).