C23H32ClNO4 — CID 101133650
2-O-methyl 4-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,4S,5R)-5-(4-chlorophenyl)pyrrolidine-2,4-dicarboxylate (PubChem CID 101133650) has the molecular formula C23H32ClNO4 and a molecular weight of 421.97 g/mol. Its IUPAC name is 2-O-methyl 4-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,4S,5R)-5-(4-chlorophenyl)pyrrolidine-2,4-dicarboxylate.
| Compound Name | 2-O-methyl 4-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,4S,5R)-5-(4-chlorophenyl)pyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 101133650 |
| Molecular Formula | C23H32ClNO4 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-O-methyl 4-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,4S,5R)-5-(4-chlorophenyl)pyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)[C@H](c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C23H32ClNO4/c1-13(2)17-10-5-14(3)11-20(17)29-22(26)18-12-19(23(27)28-4)25-21(18)15-6-8-16(24)9-7-15/h6-9,13-14,17-21,25H,5,10-12H2,1-4H3/t14-,17+,18+,19+,20-,21+/m1/s1 |
| InChIKey | KUFKXNIVCBTDFZ-CBQIQWOPSA-N |
| XLogP | 4.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |