C15H20N2 — CID 72800916
8b-(2-methylbut-3-en-2-yl)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indole (PubChem CID 72800916) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 8b-(2-methylbut-3-en-2-yl)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | 8b-(2-methylbut-3-en-2-yl)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 72800916 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 8b-(2-methylbut-3-en-2-yl)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indole |
| SMILES | C=CC(C)(C)C12CCNC1Nc1ccccc12 |
| InChI | InChI=1S/C15H20N2/c1-4-14(2,3)15-9-10-16-13(15)17-12-8-6-5-7-11(12)15/h4-8,13,16-17H,1,9-10H2,2-3H3 |
| InChIKey | OETQUZDASLGPRN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|