C10H16ClN3O2 — CID 72805643
6-chloro-3-(piperidin-4-ylmethyl)-1,3-diazinane-2,4-dione (PubChem CID 72805643) has the molecular formula C10H16ClN3O2 and a molecular weight of 245.71 g/mol. Its IUPAC name is 6-chloro-3-(piperidin-4-ylmethyl)-1,3-diazinane-2,4-dione.
| Compound Name | 6-chloro-3-(piperidin-4-ylmethyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 72805643 |
| Molecular Formula | C10H16ClN3O2 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 6-chloro-3-(piperidin-4-ylmethyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CC(Cl)NC(=O)N1CC1CCNCC1 |
| InChI | InChI=1S/C10H16ClN3O2/c11-8-5-9(15)14(10(16)13-8)6-7-1-3-12-4-2-7/h7-8,12H,1-6H2,(H,13,16) |
| InChIKey | MLBSAGIYOKHAFY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|