C10H18O3 — CID 72814776
2-ethenyl-3-(2-hydroxyethyl)-4-methylidenepentane-1,5-diol (PubChem CID 72814776) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-ethenyl-3-(2-hydroxyethyl)-4-methylidenepentane-1,5-diol.
| Compound Name | 2-ethenyl-3-(2-hydroxyethyl)-4-methylidenepentane-1,5-diol |
|---|---|
| PubChem CID | 72814776 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-ethenyl-3-(2-hydroxyethyl)-4-methylidenepentane-1,5-diol |
| SMILES | C=CC(CO)C(CCO)C(=C)CO |
| InChI | InChI=1S/C10H18O3/c1-3-9(7-13)10(4-5-11)8(2)6-12/h3,9-13H,1-2,4-7H2 |
| InChIKey | NPRYYGAEEIFLTE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|