C13H23NO3 — CID 72819797
tert-butyl 2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidine-3-carboxylate (PubChem CID 72819797) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 72819797 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | tert-butyl 2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCC1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO3/c1-7-8-10-9-16-13(5,6)14(10)11(15)17-12(2,3)4/h7,10H,1,8-9H2,2-6H3 |
| InChIKey | XVMMPDOUUWUBFG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|