C27H29NO3 — CID 7281988
(3R)-3-[2-(1-adamantyl)-2-oxoethyl]-1-benzyl-3-hydroxyindol-2-one (PubChem CID 7281988) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is (3R)-3-[2-(1-adamantyl)-2-oxoethyl]-1-benzyl-3-hydroxyindol-2-one.
| Compound Name | (3R)-3-[2-(1-adamantyl)-2-oxoethyl]-1-benzyl-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 7281988 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (3R)-3-[2-(1-adamantyl)-2-oxoethyl]-1-benzyl-3-hydroxyindol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)N(Cc2ccccc2)c2ccccc21)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H29NO3/c29-24(26-13-19-10-20(14-26)12-21(11-19)15-26)16-27(31)22-8-4-5-9-23(22)28(25(27)30)17-18-6-2-1-3-7-18/h1-9,19-21,31H,10-17H2/t19?,20?,21?,26?,27-/m1/s1 |
| InChIKey | SNRUCBFFVVLFCI-XRXOXJPUSA-N |
| XLogP | 4.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |