C28H31NO3 — CID 7281992
(3R)-3-[2-(1-adamantyl)-2-oxoethyl]-3-hydroxy-1-[(4-methylphenyl)methyl]indol-2-one (PubChem CID 7281992) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is (3R)-3-[2-(1-adamantyl)-2-oxoethyl]-3-hydroxy-1-[(4-methylphenyl)methyl]indol-2-one.
| Compound Name | (3R)-3-[2-(1-adamantyl)-2-oxoethyl]-3-hydroxy-1-[(4-methylphenyl)methyl]indol-2-one |
|---|---|
| PubChem CID | 7281992 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (3R)-3-[2-(1-adamantyl)-2-oxoethyl]-3-hydroxy-1-[(4-methylphenyl)methyl]indol-2-one |
| SMILES | Cc1ccc(CN2C(=O)[C@@](O)(CC(=O)C34CC5CC(CC(C5)C3)C4)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-18-6-8-19(9-7-18)17-29-24-5-3-2-4-23(24)28(32,26(29)31)16-25(30)27-13-20-10-21(14-27)12-22(11-20)15-27/h2-9,20-22,32H,10-17H2,1H3/t20?,21?,22?,27?,28-/m1/s1 |
| InChIKey | GOKQFTCWWZYZHN-OJDRVIBRSA-N |
| XLogP | 4.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |