C14H24N3O2+ — CID 7282554
3,6-dimethyl-1-(4-pyrrolidin-1-ium-1-ylbutyl)pyrimidine-2,4-dione (PubChem CID 7282554) has the molecular formula C14H24N3O2+ and a molecular weight of 266.36 g/mol. Its IUPAC name is 3,6-dimethyl-1-(4-pyrrolidin-1-ium-1-ylbutyl)pyrimidine-2,4-dione.
| Compound Name | 3,6-dimethyl-1-(4-pyrrolidin-1-ium-1-ylbutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 7282554 |
| Molecular Formula | C14H24N3O2+ |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 3,6-dimethyl-1-(4-pyrrolidin-1-ium-1-ylbutyl)pyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)n(C)c(=O)n1CCCC[NH+]1CCCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-12-11-13(18)15(2)14(19)17(12)10-6-5-9-16-7-3-4-8-16/h11H,3-10H2,1-2H3/p+1 |
| InChIKey | UWWZQCVMCYLHDM-UHFFFAOYSA-O |
| XLogP | -0.69 |
| TPSA | 48.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|