C21H22FN5O4S — CID 72826502
3-(2-fluoroethoxyimino)-1-[[1-(3-methylsulfonylpropyl)benzimidazol-2-yl]methyl]pyrrolo[2,3-b]pyridin-2-one (PubChem CID 72826502) has the molecular formula C21H22FN5O4S and a molecular weight of 459.50 g/mol. Its IUPAC name is 3-(2-fluoroethoxyimino)-1-[[1-(3-methylsulfonylpropyl)benzimidazol-2-yl]methyl]pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 3-(2-fluoroethoxyimino)-1-[[1-(3-methylsulfonylpropyl)benzimidazol-2-yl]methyl]pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 72826502 |
| Molecular Formula | C21H22FN5O4S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 3-(2-fluoroethoxyimino)-1-[[1-(3-methylsulfonylpropyl)benzimidazol-2-yl]methyl]pyrrolo[2,3-b]pyridin-2-one |
| SMILES | CS(=O)(=O)CCCn1c(CN2C(=O)C(=NOCCF)c3cccnc32)nc2ccccc21 |
| InChI | InChI=1S/C21H22FN5O4S/c1-32(29,30)13-5-11-26-17-8-3-2-7-16(17)24-18(26)14-27-20-15(6-4-10-23-20)19(21(27)28)25-31-12-9-22/h2-4,6-8,10H,5,9,11-14H2,1H3 |
| InChIKey | MGHRPJLBNYETFM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|