C21H20ClFN2O3 — CID 7282872
(3R)-1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-5-oxo-N-prop-2-enylpyrrolidine-3-carboxamide (PubChem CID 7282872) has the molecular formula C21H20ClFN2O3 and a molecular weight of 402.85 g/mol. Its IUPAC name is (3R)-1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-5-oxo-N-prop-2-enylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-5-oxo-N-prop-2-enylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7282872 |
| Molecular Formula | C21H20ClFN2O3 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (3R)-1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-5-oxo-N-prop-2-enylpyrrolidine-3-carboxamide |
| SMILES | C=CCNC(=O)[C@@H]1CC(=O)N(c2ccc(OCc3c(F)cccc3Cl)cc2)C1 |
| InChI | InChI=1S/C21H20ClFN2O3/c1-2-10-24-21(27)14-11-20(26)25(12-14)15-6-8-16(9-7-15)28-13-17-18(22)4-3-5-19(17)23/h2-9,14H,1,10-13H2,(H,24,27)/t14-/m1/s1 |
| InChIKey | POOFKXAXLCGYJU-CQSZACIVSA-N |
| XLogP | 3.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|