C22H18F4N2O5S — CID 72836913
[4-[(2S)-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-3-oxo-3-(prop-2-ynylamino)propyl]phenyl] ethenesulfonate (PubChem CID 72836913) has the molecular formula C22H18F4N2O5S and a molecular weight of 498.45 g/mol. Its IUPAC name is [4-[(2S)-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-3-oxo-3-(prop-2-ynylamino)propyl]phenyl] ethenesulfonate.
| Compound Name | [4-[(2S)-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-3-oxo-3-(prop-2-ynylamino)propyl]phenyl] ethenesulfonate |
|---|---|
| PubChem CID | 72836913 |
| Molecular Formula | C22H18F4N2O5S |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | [4-[(2S)-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-3-oxo-3-(prop-2-ynylamino)propyl]phenyl] ethenesulfonate |
| SMILES | C#CCNC(=O)[C@H](Cc1ccc(OS(=O)(=O)C=C)cc1)NC(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H18F4N2O5S/c1-3-11-27-21(30)19(12-14-5-8-16(9-6-14)33-34(31,32)4-2)28-20(29)15-7-10-18(23)17(13-15)22(24,25)26/h1,4-10,13,19H,2,11-12H2,(H,27,30)(H,28,29)/t19-/m0/s1 |
| InChIKey | JXZQFRXISQUMLA-IBGZPJMESA-N |
| XLogP | 2.79 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|