C16H27N5O2S — CID 72843076
(4aR,7aS)-4-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 72843076) has the molecular formula C16H27N5O2S and a molecular weight of 353.49 g/mol. Its IUPAC name is (4aR,7aS)-4-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 72843076 |
| Molecular Formula | C16H27N5O2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (4aR,7aS)-4-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CC(C)=CCN1CCN(Cc2nc(C)nn2C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H27N5O2S/c1-12(2)5-6-20-7-8-21(9-16-17-13(3)18-19(16)4)15-11-24(22,23)10-14(15)20/h5,14-15H,6-11H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | AKHACAUSHPTDQE-CABCVRRESA-N |
| XLogP | 0.37 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|