C17H29N5O2S — CID 72894543
(4aR,7aS)-1-(3-methylbut-2-enyl)-4-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 72894543) has the molecular formula C17H29N5O2S and a molecular weight of 367.52 g/mol. Its IUPAC name is (4aR,7aS)-1-(3-methylbut-2-enyl)-4-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-(3-methylbut-2-enyl)-4-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 72894543 |
| Molecular Formula | C17H29N5O2S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (4aR,7aS)-1-(3-methylbut-2-enyl)-4-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CC(C)=CCN1CCN(Cc2nncn2C(C)C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H29N5O2S/c1-13(2)5-6-20-7-8-21(16-11-25(23,24)10-15(16)20)9-17-19-18-12-22(17)14(3)4/h5,12,14-16H,6-11H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | RIMJLQQHAHHPSX-CVEARBPZSA-N |
| XLogP | 1.11 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|