C17H20N6O2 — CID 72846054
2-[[4-(5-methoxy-2-pyrazol-1-ylphenyl)triazol-1-yl]methyl]morpholine (PubChem CID 72846054) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 2-[[4-(5-methoxy-2-pyrazol-1-ylphenyl)triazol-1-yl]methyl]morpholine.
| Compound Name | 2-[[4-(5-methoxy-2-pyrazol-1-ylphenyl)triazol-1-yl]methyl]morpholine |
|---|---|
| PubChem CID | 72846054 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[[4-(5-methoxy-2-pyrazol-1-ylphenyl)triazol-1-yl]methyl]morpholine |
| SMILES | COc1ccc(-n2cccn2)c(-c2cn(CC3CNCCO3)nn2)c1 |
| InChI | InChI=1S/C17H20N6O2/c1-24-13-3-4-17(23-7-2-5-19-23)15(9-13)16-12-22(21-20-16)11-14-10-18-6-8-25-14/h2-5,7,9,12,14,18H,6,8,10-11H2,1H3 |
| InChIKey | OAVFEVSZJABUCU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |