C16H22N4O4 — CID 97204026
(2R)-2-[[4-(2,4,6-trimethoxyphenyl)triazol-1-yl]methyl]morpholine (PubChem CID 97204026) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is (2R)-2-[[4-(2,4,6-trimethoxyphenyl)triazol-1-yl]methyl]morpholine.
| Compound Name | (2R)-2-[[4-(2,4,6-trimethoxyphenyl)triazol-1-yl]methyl]morpholine |
|---|---|
| PubChem CID | 97204026 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (2R)-2-[[4-(2,4,6-trimethoxyphenyl)triazol-1-yl]methyl]morpholine |
| SMILES | COc1cc(OC)c(-c2cn(C[C@H]3CNCCO3)nn2)c(OC)c1 |
| InChI | InChI=1S/C16H22N4O4/c1-21-11-6-14(22-2)16(15(7-11)23-3)13-10-20(19-18-13)9-12-8-17-4-5-24-12/h6-7,10,12,17H,4-5,8-9H2,1-3H3/t12-/m1/s1 |
| InChIKey | KUEMBACKAKVVDP-GFCCVEGCSA-N |
| XLogP | 0.96 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |