C21H19FN4O — CID 72847538
6-fluoro-2-[[[2-(2-methylimidazol-1-yl)phenyl]methylamino]methyl]-1H-quinolin-4-one (PubChem CID 72847538) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is 6-fluoro-2-[[[2-(2-methylimidazol-1-yl)phenyl]methylamino]methyl]-1H-quinolin-4-one.
| Compound Name | 6-fluoro-2-[[[2-(2-methylimidazol-1-yl)phenyl]methylamino]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 72847538 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 6-fluoro-2-[[[2-(2-methylimidazol-1-yl)phenyl]methylamino]methyl]-1H-quinolin-4-one |
| SMILES | Cc1nccn1-c1ccccc1CNCc1cc(=O)c2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C21H19FN4O/c1-14-24-8-9-26(14)20-5-3-2-4-15(20)12-23-13-17-11-21(27)18-10-16(22)6-7-19(18)25-17/h2-11,23H,12-13H2,1H3,(H,25,27) |
| InChIKey | WMEQQUMDDAXZBW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |