C15H16FN5O — CID 72842668
6-fluoro-2-[[2-(2-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]-1H-quinolin-4-one (PubChem CID 72842668) has the molecular formula C15H16FN5O and a molecular weight of 301.33 g/mol. Its IUPAC name is 6-fluoro-2-[[2-(2-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]-1H-quinolin-4-one.
| Compound Name | 6-fluoro-2-[[2-(2-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 72842668 |
| Molecular Formula | C15H16FN5O |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 6-fluoro-2-[[2-(2-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]-1H-quinolin-4-one |
| SMILES | Cn1ncnc1CCNCc1cc(=O)c2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C15H16FN5O/c1-21-15(18-9-19-21)4-5-17-8-11-7-14(22)12-6-10(16)2-3-13(12)20-11/h2-3,6-7,9,17H,4-5,8H2,1H3,(H,20,22) |
| InChIKey | SDNTWVZMQNDSRH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|