C18H25FN4O — CID 134080266
2-[[3-(3,5-dimethylpyrazolidin-4-yl)propylamino]methyl]-6-fluoro-1H-quinolin-4-one (PubChem CID 134080266) has the molecular formula C18H25FN4O and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[[3-(3,5-dimethylpyrazolidin-4-yl)propylamino]methyl]-6-fluoro-1H-quinolin-4-one.
| Compound Name | 2-[[3-(3,5-dimethylpyrazolidin-4-yl)propylamino]methyl]-6-fluoro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 134080266 |
| Molecular Formula | C18H25FN4O |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[[3-(3,5-dimethylpyrazolidin-4-yl)propylamino]methyl]-6-fluoro-1H-quinolin-4-one |
| SMILES | CC1NNC(C)C1CCCNCc1cc(=O)c2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C18H25FN4O/c1-11-15(12(2)23-22-11)4-3-7-20-10-14-9-18(24)16-8-13(19)5-6-17(16)21-14/h5-6,8-9,11-12,15,20,22-23H,3-4,7,10H2,1-2H3,(H,21,24) |
| InChIKey | TZDXDJAZJRJXMC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|