C20H18F2N4O — CID 72856967
1-[1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-phenylurea (PubChem CID 72856967) has the molecular formula C20H18F2N4O and a molecular weight of 368.39 g/mol. Its IUPAC name is 1-[1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-phenylurea.
| Compound Name | 1-[1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 72856967 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-[1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC1CCCc2c1cnn2-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H18F2N4O/c21-13-9-14(22)11-16(10-13)26-19-8-4-7-18(17(19)12-23-26)25-20(27)24-15-5-2-1-3-6-15/h1-3,5-6,9-12,18H,4,7-8H2,(H2,24,25,27) |
| InChIKey | XUFKNYBIRITVIY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |