C20H25F2N3O2 — CID 97132643
N-[(4S)-1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-6-methoxyhexanamide (PubChem CID 97132643) has the molecular formula C20H25F2N3O2 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[(4S)-1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-6-methoxyhexanamide.
| Compound Name | N-[(4S)-1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-6-methoxyhexanamide |
|---|---|
| PubChem CID | 97132643 |
| Molecular Formula | C20H25F2N3O2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[(4S)-1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-6-methoxyhexanamide |
| SMILES | COCCCCCC(=O)N[C@H]1CCCc2c1cnn2-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H25F2N3O2/c1-27-9-4-2-3-8-20(26)24-18-6-5-7-19-17(18)13-23-25(19)16-11-14(21)10-15(22)12-16/h10-13,18H,2-9H2,1H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | BAQKDIQGKLZXRA-SFHVURJKSA-N |
| XLogP | 3.85 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|