C21H26N4O5+2 — CID 7285909
N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]-3-nitrobenzamide (PubChem CID 7285909) has the molecular formula C21H26N4O5+2 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]-3-nitrobenzamide.
| Compound Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 7285909 |
| Molecular Formula | C21H26N4O5+2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]-3-nitrobenzamide |
| SMILES | C[NH+]1CC[NH+]([C@H](CNC(=O)c2cccc([N+](=O)[O-])c2)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H24N4O5/c1-23-7-9-24(10-8-23)18(15-5-6-19-20(12-15)30-14-29-19)13-22-21(26)16-3-2-4-17(11-16)25(27)28/h2-6,11-12,18H,7-10,13-14H2,1H3,(H,22,26)/p+2/t18-/m1/s1 |
| InChIKey | ATNQPLWMPJIGRO-GOSISDBHSA-P |
| XLogP | -0.79 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|