C18H21N5O — CID 72861594
1-cyclopentyl-4-(4-pyridin-3-ylpyrimidin-2-yl)piperazin-2-one (PubChem CID 72861594) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-cyclopentyl-4-(4-pyridin-3-ylpyrimidin-2-yl)piperazin-2-one.
| Compound Name | 1-cyclopentyl-4-(4-pyridin-3-ylpyrimidin-2-yl)piperazin-2-one |
|---|---|
| PubChem CID | 72861594 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-cyclopentyl-4-(4-pyridin-3-ylpyrimidin-2-yl)piperazin-2-one |
| SMILES | O=C1CN(c2nccc(-c3cccnc3)n2)CCN1C1CCCC1 |
| InChI | InChI=1S/C18H21N5O/c24-17-13-22(10-11-23(17)15-5-1-2-6-15)18-20-9-7-16(21-18)14-4-3-8-19-12-14/h3-4,7-9,12,15H,1-2,5-6,10-11,13H2 |
| InChIKey | XZYJGJASWHMPFY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |