C17H28N4O — CID 72864387
(4aS,8aS)-2-ethyl-7-(6-ethyl-2-methylpyrimidin-4-yl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol (PubChem CID 72864387) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is (4aS,8aS)-2-ethyl-7-(6-ethyl-2-methylpyrimidin-4-yl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol.
| Compound Name | (4aS,8aS)-2-ethyl-7-(6-ethyl-2-methylpyrimidin-4-yl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol |
|---|---|
| PubChem CID | 72864387 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | (4aS,8aS)-2-ethyl-7-(6-ethyl-2-methylpyrimidin-4-yl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol |
| SMILES | CCc1cc(N2CC[C@@]3(O)CCN(CC)C[C@H]3C2)nc(C)n1 |
| InChI | InChI=1S/C17H28N4O/c1-4-15-10-16(19-13(3)18-15)21-9-7-17(22)6-8-20(5-2)11-14(17)12-21/h10,14,22H,4-9,11-12H2,1-3H3/t14-,17-/m0/s1 |
| InChIKey | BLPQYJBPBIGGPB-YOEHRIQHSA-N |
| XLogP | 1.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |