C18H26N4O — CID 133461987
1-cyclopropyl-6-(6-ethyl-2-methylpyrimidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 133461987) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-cyclopropyl-6-(6-ethyl-2-methylpyrimidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | 1-cyclopropyl-6-(6-ethyl-2-methylpyrimidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 133461987 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-cyclopropyl-6-(6-ethyl-2-methylpyrimidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCc1cc(N2CCC3C(CCC(=O)N3C3CC3)C2)nc(C)n1 |
| InChI | InChI=1S/C18H26N4O/c1-3-14-10-17(20-12(2)19-14)21-9-8-16-13(11-21)4-7-18(23)22(16)15-5-6-15/h10,13,15-16H,3-9,11H2,1-2H3 |
| InChIKey | YNAZTBIJUGMIJP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |