C15H19ClN4O2 — CID 98891047
(4aS,8aS)-6-(5-chloro-6-oxo-1H-pyridazin-4-yl)-1-cyclopropyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 98891047) has the molecular formula C15H19ClN4O2 and a molecular weight of 322.80 g/mol. Its IUPAC name is (4aS,8aS)-6-(5-chloro-6-oxo-1H-pyridazin-4-yl)-1-cyclopropyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aS)-6-(5-chloro-6-oxo-1H-pyridazin-4-yl)-1-cyclopropyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 98891047 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (4aS,8aS)-6-(5-chloro-6-oxo-1H-pyridazin-4-yl)-1-cyclopropyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@H]2CN(c3cn[nH]c(=O)c3Cl)CC[C@@H]2N1C1CC1 |
| InChI | InChI=1S/C15H19ClN4O2/c16-14-12(7-17-18-15(14)22)19-6-5-11-9(8-19)1-4-13(21)20(11)10-2-3-10/h7,9-11H,1-6,8H2,(H,18,22)/t9-,11-/m0/s1 |
| InChIKey | BHDLAYHCMDZGIN-ONGXEEELSA-N |
| XLogP | 1.40 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |