C16H18N2O — CID 72868078
3-(3,4-dihydro-2H-chromen-3-ylmethyl)-2,5-dimethylpyrazine (PubChem CID 72868078) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-3-ylmethyl)-2,5-dimethylpyrazine.
| Compound Name | 3-(3,4-dihydro-2H-chromen-3-ylmethyl)-2,5-dimethylpyrazine |
|---|---|
| PubChem CID | 72868078 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-3-ylmethyl)-2,5-dimethylpyrazine |
| SMILES | Cc1cnc(C)c(CC2COc3ccccc3C2)n1 |
| InChI | InChI=1S/C16H18N2O/c1-11-9-17-12(2)15(18-11)8-13-7-14-5-3-4-6-16(14)19-10-13/h3-6,9,13H,7-8,10H2,1-2H3 |
| InChIKey | PHEYPOZSPBNXIJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |