C22H23N3O4 — CID 7286929
N-(2,5-dimethylphenyl)-2-[4-(2-methoxy-5-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide (PubChem CID 7286929) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[4-(2-methoxy-5-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[4-(2-methoxy-5-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 7286929 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[4-(2-methoxy-5-methylphenyl)-2,3-dioxopyrazin-1-yl]acetamide |
| SMILES | COc1ccc(C)cc1-n1ccn(CC(=O)Nc2cc(C)ccc2C)c(=O)c1=O |
| InChI | InChI=1S/C22H23N3O4/c1-14-5-7-16(3)17(11-14)23-20(26)13-24-9-10-25(22(28)21(24)27)18-12-15(2)6-8-19(18)29-4/h5-12H,13H2,1-4H3,(H,23,26) |
| InChIKey | UJRSQKGOQRPRTI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|